About but-3-yn-2-yl 5-phenylpentanoate
but-3-yn-2-yl 5-phenylpentanoate (PubChem CID 91699543) has the molecular formula C15H18O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is but-3-yn-2-yl 5-phenylpentanoate.
Molecular Properties
| Compound Name | but-3-yn-2-yl 5-phenylpentanoate |
| PubChem CID | 91699543 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | but-3-yn-2-yl 5-phenylpentanoate |
| SMILES | C#CC(C)OC(=O)CCCCc1ccccc1 |
| InChI | InChI=1S/C15H18O2/c1-3-13(2)17-15(16)12-8-7-11-14-9-5-4-6-10-14/h1,4-6,9-10,13H,7-8,11-12H2,2H3 |
| InChIKey | JPFQPKFSPTWNOX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-3-yn-2-yl 5-phenylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-yn-2-yl 5-phenylpentanoate?
The IUPAC name of but-3-yn-2-yl 5-phenylpentanoate (CID 91699543) is but-3-yn-2-yl 5-phenylpentanoate.
What is the SMILES notation for but-3-yn-2-yl 5-phenylpentanoate?
The canonical SMILES for but-3-yn-2-yl 5-phenylpentanoate is C#CC(C)OC(=O)CCCCc1ccccc1.
What is the InChIKey of but-3-yn-2-yl 5-phenylpentanoate?
The InChIKey is JPFQPKFSPTWNOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O2/c1-3-13(2)17-15(16)12-8-7-11-14-9-5-4-6-10-14/h1,4-6,9-10,13H,7-8,11-12H2,2H3.
What are the key properties of but-3-yn-2-yl 5-phenylpentanoate?
but-3-yn-2-yl 5-phenylpentanoate has a molecular weight of 230.31 g/mol, XLogP of 2.96, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-yn-2-yl 5-phenylpentanoate is sourced from PubChem (CID 91699543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).