C21H33NO3 — CID 171342570
[1-(tert-butylamino)-3-methyl-1-oxobutan-2-yl] 6-phenylhexanoate (PubChem CID 171342570) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is [1-(tert-butylamino)-3-methyl-1-oxobutan-2-yl] 6-phenylhexanoate.
| Compound Name | [1-(tert-butylamino)-3-methyl-1-oxobutan-2-yl] 6-phenylhexanoate |
|---|---|
| PubChem CID | 171342570 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | [1-(tert-butylamino)-3-methyl-1-oxobutan-2-yl] 6-phenylhexanoate |
| SMILES | CC(C)C(OC(=O)CCCCCc1ccccc1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C21H33NO3/c1-16(2)19(20(24)22-21(3,4)5)25-18(23)15-11-7-10-14-17-12-8-6-9-13-17/h6,8-9,12-13,16,19H,7,10-11,14-15H2,1-5H3,(H,22,24) |
| InChIKey | UDFGVKJPAIKCLT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|