C29H40O5S — CID 15077427
2-hydroxy-3-(3-oxo-3-propan-2-yloxypropyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]propanoic acid (PubChem CID 15077427) has the molecular formula C29H40O5S and a molecular weight of 500.70 g/mol. Its IUPAC name is 2-hydroxy-3-(3-oxo-3-propan-2-yloxypropyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]propanoic acid.
| Compound Name | 2-hydroxy-3-(3-oxo-3-propan-2-yloxypropyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 15077427 |
| Molecular Formula | C29H40O5S |
| Molecular Weight | 500.70 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | 2-hydroxy-3-(3-oxo-3-propan-2-yloxypropyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]propanoic acid |
| SMILES | CC(C)OC(=O)CCSC(c1ccccc1CCCCCCCCc1ccccc1)C(O)C(=O)O |
| InChI | InChI=1S/C29H40O5S/c1-22(2)34-26(30)20-21-35-28(27(31)29(32)33)25-19-13-12-18-24(25)17-11-6-4-3-5-8-14-23-15-9-7-10-16-23/h7,9-10,12-13,15-16,18-19,22,27-28,31H,3-6,8,11,14,17,20-21H2,1-2H3,(H,32,33) |
| InChIKey | GRPHSRDFFVDFPT-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.70 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|