C33H40O5S — CID 11364850
phenyl (2S,3R)-2-hydroxy-3-(3-methoxy-3-oxopropyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]propanoate (PubChem CID 11364850) has the molecular formula C33H40O5S and a molecular weight of 548.75 g/mol. Its IUPAC name is phenyl (2S,3R)-2-hydroxy-3-(3-methoxy-3-oxopropyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]propanoate.
| Compound Name | phenyl (2S,3R)-2-hydroxy-3-(3-methoxy-3-oxopropyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]propanoate |
|---|---|
| PubChem CID | 11364850 |
| Molecular Formula | C33H40O5S |
| Molecular Weight | 548.75 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | phenyl (2S,3R)-2-hydroxy-3-(3-methoxy-3-oxopropyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]propanoate |
| SMILES | COC(=O)CCS[C@H](c1ccccc1CCCCCCCCc1ccccc1)[C@@H](O)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C33H40O5S/c1-37-30(34)24-25-39-32(31(35)33(36)38-28-21-12-7-13-22-28)29-23-15-14-20-27(29)19-11-5-3-2-4-8-16-26-17-9-6-10-18-26/h6-7,9-10,12-15,17-18,20-23,31-32,35H,2-5,8,11,16,19,24-25H2,1H3/t31-,32-/m1/s1 |
| InChIKey | LEOULRZBVLVACY-ROJLCIKYSA-N |
| XLogP | 7.12 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.75 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|