C28H38O5S — CID 67944208
2-hydroxy-3-(3-methoxy-3-oxopropyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]butanoic acid (PubChem CID 67944208) has the molecular formula C28H38O5S and a molecular weight of 486.67 g/mol. Its IUPAC name is 2-hydroxy-3-(3-methoxy-3-oxopropyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]butanoic acid.
| Compound Name | 2-hydroxy-3-(3-methoxy-3-oxopropyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 67944208 |
| Molecular Formula | C28H38O5S |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 2-hydroxy-3-(3-methoxy-3-oxopropyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]butanoic acid |
| SMILES | COC(=O)CCSC(C)(c1ccccc1CCCCCCCCc1ccccc1)C(O)C(=O)O |
| InChI | InChI=1S/C28H38O5S/c1-28(26(30)27(31)32,34-21-20-25(29)33-2)24-19-13-12-18-23(24)17-11-6-4-3-5-8-14-22-15-9-7-10-16-22/h7,9-10,12-13,15-16,18-19,26,30H,3-6,8,11,14,17,20-21H2,1-2H3,(H,31,32) |
| InChIKey | GTMQDVZNHTVBEV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|