C32H38O6S — CID 19023810
3-[[2-carboxy-2-hydroxy-1-[2-(8-phenyloctyl)phenyl]ethyl]sulfanylmethyl]-4-methoxybenzoic acid (PubChem CID 19023810) has the molecular formula C32H38O6S and a molecular weight of 550.72 g/mol. Its IUPAC name is 3-[[2-carboxy-2-hydroxy-1-[2-(8-phenyloctyl)phenyl]ethyl]sulfanylmethyl]-4-methoxybenzoic acid.
| Compound Name | 3-[[2-carboxy-2-hydroxy-1-[2-(8-phenyloctyl)phenyl]ethyl]sulfanylmethyl]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 19023810 |
| Molecular Formula | C32H38O6S |
| Molecular Weight | 550.72 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 3-[[2-carboxy-2-hydroxy-1-[2-(8-phenyloctyl)phenyl]ethyl]sulfanylmethyl]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1CSC(c1ccccc1CCCCCCCCc1ccccc1)C(O)C(=O)O |
| InChI | InChI=1S/C32H38O6S/c1-38-28-20-19-25(31(34)35)21-26(28)22-39-30(29(33)32(36)37)27-18-12-11-17-24(27)16-10-5-3-2-4-7-13-23-14-8-6-9-15-23/h6,8-9,11-12,14-15,17-21,29-30,33H,2-5,7,10,13,16,22H2,1H3,(H,34,35)(H,36,37) |
| InChIKey | WJPULRQLAZPKHM-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.72 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|