C33H40O6S — CID 67849912
3-[carboxy-(2-methoxyphenyl)methyl]sulfanyl-2-methoxy-3-[2-(8-phenyloctyl)phenyl]propanoic acid (PubChem CID 67849912) has the molecular formula C33H40O6S and a molecular weight of 564.74 g/mol. Its IUPAC name is 3-[carboxy-(2-methoxyphenyl)methyl]sulfanyl-2-methoxy-3-[2-(8-phenyloctyl)phenyl]propanoic acid.
| Compound Name | 3-[carboxy-(2-methoxyphenyl)methyl]sulfanyl-2-methoxy-3-[2-(8-phenyloctyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 67849912 |
| Molecular Formula | C33H40O6S |
| Molecular Weight | 564.74 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | 3-[carboxy-(2-methoxyphenyl)methyl]sulfanyl-2-methoxy-3-[2-(8-phenyloctyl)phenyl]propanoic acid |
| SMILES | COc1ccccc1C(SC(c1ccccc1CCCCCCCCc1ccccc1)C(OC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C33H40O6S/c1-38-28-23-15-14-22-27(28)31(33(36)37)40-30(29(39-2)32(34)35)26-21-13-12-20-25(26)19-11-6-4-3-5-8-16-24-17-9-7-10-18-24/h7,9-10,12-15,17-18,20-23,29-31H,3-6,8,11,16,19H2,1-2H3,(H,34,35)(H,36,37) |
| InChIKey | XOLCRHVPFIGJLW-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.74 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|