C18H26O4S — CID 19817968
2-(carboxymethylsulfanyl)-2-(2-octylphenyl)acetic acid (PubChem CID 19817968) has the molecular formula C18H26O4S and a molecular weight of 338.47 g/mol. Its IUPAC name is 2-(carboxymethylsulfanyl)-2-(2-octylphenyl)acetic acid.
| Compound Name | 2-(carboxymethylsulfanyl)-2-(2-octylphenyl)acetic acid |
|---|---|
| PubChem CID | 19817968 |
| Molecular Formula | C18H26O4S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-(carboxymethylsulfanyl)-2-(2-octylphenyl)acetic acid |
| SMILES | CCCCCCCCc1ccccc1C(SCC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H26O4S/c1-2-3-4-5-6-7-10-14-11-8-9-12-15(14)17(18(21)22)23-13-16(19)20/h8-9,11-12,17H,2-7,10,13H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | TWOIYQZOFCOXJX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|