C33H40O5S — CID 67849723
3-[(2-methoxy-4-methoxycarbonylphenyl)methylsulfanyl]-3-[2-(8-phenyloctyl)phenyl]propanoic acid (PubChem CID 67849723) has the molecular formula C33H40O5S and a molecular weight of 548.75 g/mol. Its IUPAC name is 3-[(2-methoxy-4-methoxycarbonylphenyl)methylsulfanyl]-3-[2-(8-phenyloctyl)phenyl]propanoic acid.
| Compound Name | 3-[(2-methoxy-4-methoxycarbonylphenyl)methylsulfanyl]-3-[2-(8-phenyloctyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 67849723 |
| Molecular Formula | C33H40O5S |
| Molecular Weight | 548.75 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | 3-[(2-methoxy-4-methoxycarbonylphenyl)methylsulfanyl]-3-[2-(8-phenyloctyl)phenyl]propanoic acid |
| SMILES | COC(=O)c1ccc(CSC(CC(=O)O)c2ccccc2CCCCCCCCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C33H40O5S/c1-37-30-22-27(33(36)38-2)20-21-28(30)24-39-31(23-32(34)35)29-19-13-12-18-26(29)17-11-6-4-3-5-8-14-25-15-9-7-10-16-25/h7,9-10,12-13,15-16,18-22,31H,3-6,8,11,14,17,23-24H2,1-2H3,(H,34,35) |
| InChIKey | OESBQBVHMFWNMU-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.75 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|