C31H42O6S — CID 177418403
4-[[(Z,4S,5S)-8-carboxy-1-(4-heptylphenyl)-5-hydroxyoct-2-en-4-yl]sulfanylmethyl]-3-methoxybenzoic acid (PubChem CID 177418403) has the molecular formula C31H42O6S and a molecular weight of 542.74 g/mol. Its IUPAC name is 4-[[(Z,4S,5S)-8-carboxy-1-(4-heptylphenyl)-5-hydroxyoct-2-en-4-yl]sulfanylmethyl]-3-methoxybenzoic acid.
| Compound Name | 4-[[(Z,4S,5S)-8-carboxy-1-(4-heptylphenyl)-5-hydroxyoct-2-en-4-yl]sulfanylmethyl]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 177418403 |
| Molecular Formula | C31H42O6S |
| Molecular Weight | 542.74 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 4-[[(Z,4S,5S)-8-carboxy-1-(4-heptylphenyl)-5-hydroxyoct-2-en-4-yl]sulfanylmethyl]-3-methoxybenzoic acid |
| SMILES | CCCCCCCc1ccc(C/C=C\[C@H](SCc2ccc(C(=O)O)cc2OC)[C@@H](O)CCCC(=O)O)cc1 |
| InChI | InChI=1S/C31H42O6S/c1-3-4-5-6-7-10-23-15-17-24(18-16-23)11-8-13-29(27(32)12-9-14-30(33)34)38-22-26-20-19-25(31(35)36)21-28(26)37-2/h8,13,15-21,27,29,32H,3-7,9-12,14,22H2,1-2H3,(H,33,34)(H,35,36)/b13-8-/t27-,29-/m0/s1 |
| InChIKey | FDJAQZAHMLOHQY-CISYEGMTSA-N |
| XLogP | 6.92 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.74 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|