C27H42N2O6S — CID 122197294
(E,5R,6S)-6-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]sulfanyl-9-(3-heptylphenyl)-5-hydroxynon-7-enoic acid (PubChem CID 122197294) has the molecular formula C27H42N2O6S and a molecular weight of 522.71 g/mol. Its IUPAC name is (E,5R,6S)-6-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]sulfanyl-9-(3-heptylphenyl)-5-hydroxynon-7-enoic acid.
| Compound Name | (E,5R,6S)-6-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]sulfanyl-9-(3-heptylphenyl)-5-hydroxynon-7-enoic acid |
|---|---|
| PubChem CID | 122197294 |
| Molecular Formula | C27H42N2O6S |
| Molecular Weight | 522.71 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | (E,5R,6S)-6-[(2R)-2-amino-3-(carboxymethylamino)-3-oxopropyl]sulfanyl-9-(3-heptylphenyl)-5-hydroxynon-7-enoic acid |
| SMILES | CCCCCCCc1cccc(C/C=C/[C@H](SC[C@H](N)C(=O)NCC(=O)O)[C@H](O)CCCC(=O)O)c1 |
| InChI | InChI=1S/C27H42N2O6S/c1-2-3-4-5-6-10-20-11-7-12-21(17-20)13-8-15-24(23(30)14-9-16-25(31)32)36-19-22(28)27(35)29-18-26(33)34/h7-8,11-12,15,17,22-24,30H,2-6,9-10,13-14,16,18-19,28H2,1H3,(H,29,35)(H,31,32)(H,33,34)/b15-8+/t22-,23+,24-/m0/s1 |
| InChIKey | LWAZWSWCKUOPJI-VWONQZLDSA-N |
| XLogP | 3.54 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.71 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|