C32H42O5S — CID 14015592
(Z,5S,6R)-6-[[3-[(E)-2-carboxyethenyl]phenyl]methylsulfanyl]-9-(4-heptylphenyl)-5-hydroxynon-7-enoic acid (PubChem CID 14015592) has the molecular formula C32H42O5S and a molecular weight of 538.75 g/mol. Its IUPAC name is (Z,5S,6R)-6-[[3-[(E)-2-carboxyethenyl]phenyl]methylsulfanyl]-9-(4-heptylphenyl)-5-hydroxynon-7-enoic acid.
| Compound Name | (Z,5S,6R)-6-[[3-[(E)-2-carboxyethenyl]phenyl]methylsulfanyl]-9-(4-heptylphenyl)-5-hydroxynon-7-enoic acid |
|---|---|
| PubChem CID | 14015592 |
| Molecular Formula | C32H42O5S |
| Molecular Weight | 538.75 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | (Z,5S,6R)-6-[[3-[(E)-2-carboxyethenyl]phenyl]methylsulfanyl]-9-(4-heptylphenyl)-5-hydroxynon-7-enoic acid |
| SMILES | CCCCCCCc1ccc(C/C=C\[C@@H](SCc2cccc(/C=C/C(=O)O)c2)[C@@H](O)CCCC(=O)O)cc1 |
| InChI | InChI=1S/C32H42O5S/c1-2-3-4-5-6-10-25-17-19-26(20-18-25)11-8-15-30(29(33)14-9-16-31(34)35)38-24-28-13-7-12-27(23-28)21-22-32(36)37/h7-8,12-13,15,17-23,29-30,33H,2-6,9-11,14,16,24H2,1H3,(H,34,35)(H,36,37)/b15-8-,22-21+/t29-,30+/m0/s1 |
| InChIKey | ICZISTFLDDMSJH-RMXCHUOKSA-N |
| XLogP | 7.31 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.75 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|