C30H39NO7S — CID 14015564
4-[[(Z,4R,5S)-8-carboxy-1-(4-heptylphenyl)-5-hydroxyoct-2-en-4-yl]sulfanylmethyl]-3-nitrobenzoic acid (PubChem CID 14015564) has the molecular formula C30H39NO7S and a molecular weight of 557.71 g/mol. Its IUPAC name is 4-[[(Z,4R,5S)-8-carboxy-1-(4-heptylphenyl)-5-hydroxyoct-2-en-4-yl]sulfanylmethyl]-3-nitrobenzoic acid.
| Compound Name | 4-[[(Z,4R,5S)-8-carboxy-1-(4-heptylphenyl)-5-hydroxyoct-2-en-4-yl]sulfanylmethyl]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 14015564 |
| Molecular Formula | C30H39NO7S |
| Molecular Weight | 557.71 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 4-[[(Z,4R,5S)-8-carboxy-1-(4-heptylphenyl)-5-hydroxyoct-2-en-4-yl]sulfanylmethyl]-3-nitrobenzoic acid |
| SMILES | CCCCCCCc1ccc(C/C=C\[C@@H](SCc2ccc(C(=O)O)cc2[N+](=O)[O-])[C@@H](O)CCCC(=O)O)cc1 |
| InChI | InChI=1S/C30H39NO7S/c1-2-3-4-5-6-9-22-14-16-23(17-15-22)10-7-12-28(27(32)11-8-13-29(33)34)39-21-25-19-18-24(30(35)36)20-26(25)31(37)38/h7,12,14-20,27-28,32H,2-6,8-11,13,21H2,1H3,(H,33,34)(H,35,36)/b12-7-/t27-,28+/m0/s1 |
| InChIKey | KHISNWKTTYQCLL-QUCVIOJBSA-N |
| XLogP | 6.82 |
| TPSA | 137.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.71 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|