C30H41NO5S — CID 14015576
2-amino-4-[[(Z,4R,5S)-8-carboxy-1-(4-heptylphenyl)-5-hydroxyoct-2-en-4-yl]sulfanylmethyl]benzoic acid (PubChem CID 14015576) has the molecular formula C30H41NO5S and a molecular weight of 527.73 g/mol. Its IUPAC name is 2-amino-4-[[(Z,4R,5S)-8-carboxy-1-(4-heptylphenyl)-5-hydroxyoct-2-en-4-yl]sulfanylmethyl]benzoic acid.
| Compound Name | 2-amino-4-[[(Z,4R,5S)-8-carboxy-1-(4-heptylphenyl)-5-hydroxyoct-2-en-4-yl]sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 14015576 |
| Molecular Formula | C30H41NO5S |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | 2-amino-4-[[(Z,4R,5S)-8-carboxy-1-(4-heptylphenyl)-5-hydroxyoct-2-en-4-yl]sulfanylmethyl]benzoic acid |
| SMILES | CCCCCCCc1ccc(C/C=C\[C@@H](SCc2ccc(C(=O)O)c(N)c2)[C@@H](O)CCCC(=O)O)cc1 |
| InChI | InChI=1S/C30H41NO5S/c1-2-3-4-5-6-9-22-14-16-23(17-15-22)10-7-12-28(27(32)11-8-13-29(33)34)37-21-24-18-19-25(30(35)36)26(31)20-24/h7,12,14-20,27-28,32H,2-6,8-11,13,21,31H2,1H3,(H,33,34)(H,35,36)/b12-7-/t27-,28+/m0/s1 |
| InChIKey | DZNHFEPNIWGBBP-QUCVIOJBSA-N |
| XLogP | 6.50 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|