C20H24O4S — CID 70487172
(Z,5R,6S)-6-(furan-2-ylmethylsulfanyl)-5-hydroxy-9-phenylnon-7-enoic acid (PubChem CID 70487172) has the molecular formula C20H24O4S and a molecular weight of 360.48 g/mol. Its IUPAC name is (Z,5R,6S)-6-(furan-2-ylmethylsulfanyl)-5-hydroxy-9-phenylnon-7-enoic acid.
| Compound Name | (Z,5R,6S)-6-(furan-2-ylmethylsulfanyl)-5-hydroxy-9-phenylnon-7-enoic acid |
|---|---|
| PubChem CID | 70487172 |
| Molecular Formula | C20H24O4S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (Z,5R,6S)-6-(furan-2-ylmethylsulfanyl)-5-hydroxy-9-phenylnon-7-enoic acid |
| SMILES | O=C(O)CCC[C@@H](O)[C@H](/C=C\Cc1ccccc1)SCc1ccco1 |
| InChI | InChI=1S/C20H24O4S/c21-18(11-5-13-20(22)23)19(25-15-17-10-6-14-24-17)12-4-9-16-7-2-1-3-8-16/h1-4,6-8,10,12,14,18-19,21H,5,9,11,13,15H2,(H,22,23)/b12-4-/t18-,19+/m1/s1 |
| InChIKey | HCCWLUIGJSBQRO-NHYUBPSNSA-N |
| XLogP | 4.30 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|