C32H37FO5S — CID 67832862
(2S,3R)-3-[(2-fluoro-4-methoxycarbonylphenyl)methylsulfanyl]-2-hydroxy-3-[2-(8-phenyloctyl)phenyl]propanoic acid (PubChem CID 67832862) has the molecular formula C32H37FO5S and a molecular weight of 552.71 g/mol. Its IUPAC name is (2S,3R)-3-[(2-fluoro-4-methoxycarbonylphenyl)methylsulfanyl]-2-hydroxy-3-[2-(8-phenyloctyl)phenyl]propanoic acid.
| Compound Name | (2S,3R)-3-[(2-fluoro-4-methoxycarbonylphenyl)methylsulfanyl]-2-hydroxy-3-[2-(8-phenyloctyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 67832862 |
| Molecular Formula | C32H37FO5S |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | (2S,3R)-3-[(2-fluoro-4-methoxycarbonylphenyl)methylsulfanyl]-2-hydroxy-3-[2-(8-phenyloctyl)phenyl]propanoic acid |
| SMILES | COC(=O)c1ccc(CS[C@H](c2ccccc2CCCCCCCCc2ccccc2)[C@@H](O)C(=O)O)c(F)c1 |
| InChI | InChI=1S/C32H37FO5S/c1-38-32(37)25-19-20-26(28(33)21-25)22-39-30(29(34)31(35)36)27-18-12-11-17-24(27)16-10-5-3-2-4-7-13-23-14-8-6-9-15-23/h6,8-9,11-12,14-15,17-21,29-30,34H,2-5,7,10,13,16,22H2,1H3,(H,35,36)/t29-,30-/m1/s1 |
| InChIKey | WOLZSNLWJJLLNJ-LOYHVIPDSA-N |
| XLogP | 7.16 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|