C19H34N3O3+3 — CID 9169966
(4S)-5,6,7-trimethoxy-4-(4-propylpiperazine-1,4-diium-1-yl)-1,2,3,4-tetrahydroisoquinolin-2-ium (PubChem CID 9169966) has the molecular formula C19H34N3O3+3 and a molecular weight of 352.50 g/mol. Its IUPAC name is (4S)-5,6,7-trimethoxy-4-(4-propylpiperazine-1,4-diium-1-yl)-1,2,3,4-tetrahydroisoquinolin-2-ium.
| Compound Name | (4S)-5,6,7-trimethoxy-4-(4-propylpiperazine-1,4-diium-1-yl)-1,2,3,4-tetrahydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 9169966 |
| Molecular Formula | C19H34N3O3+3 |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | (4S)-5,6,7-trimethoxy-4-(4-propylpiperazine-1,4-diium-1-yl)-1,2,3,4-tetrahydroisoquinolin-2-ium |
| SMILES | CCC[NH+]1CC[NH+]([C@@H]2C[NH2+]Cc3cc(OC)c(OC)c(OC)c32)CC1 |
| InChI | InChI=1S/C19H31N3O3/c1-5-6-21-7-9-22(10-8-21)15-13-20-12-14-11-16(23-2)18(24-3)19(25-4)17(14)15/h11,15,20H,5-10,12-13H2,1-4H3/p+3/t15-/m1/s1 |
| InChIKey | PJZXUFTVIIJLLY-OAHLLOKOSA-Q |
| XLogP | -1.98 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |