C18H32N3O3+3 — CID 9170025
(4R)-4-(4-ethylpiperazine-1,4-diium-1-yl)-6,7,8-trimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium (PubChem CID 9170025) has the molecular formula C18H32N3O3+3 and a molecular weight of 338.47 g/mol. Its IUPAC name is (4R)-4-(4-ethylpiperazine-1,4-diium-1-yl)-6,7,8-trimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium.
| Compound Name | (4R)-4-(4-ethylpiperazine-1,4-diium-1-yl)-6,7,8-trimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 9170025 |
| Molecular Formula | C18H32N3O3+3 |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | (4R)-4-(4-ethylpiperazine-1,4-diium-1-yl)-6,7,8-trimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium |
| SMILES | CC[NH+]1CC[NH+]([C@H]2C[NH2+]Cc3c2cc(OC)c(OC)c3OC)CC1 |
| InChI | InChI=1S/C18H29N3O3/c1-5-20-6-8-21(9-7-20)15-12-19-11-14-13(15)10-16(22-2)18(24-4)17(14)23-3/h10,15,19H,5-9,11-12H2,1-4H3/p+3/t15-/m0/s1 |
| InChIKey | PLBSDDPLEJGYJB-HNNXBMFYSA-Q |
| XLogP | -2.37 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |