C20H29NO4 — CID 91699750
4-methylpentyl 1-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylate (PubChem CID 91699750) has the molecular formula C20H29NO4 and a molecular weight of 347.45 g/mol. Its IUPAC name is 4-methylpentyl 1-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylate.
| Compound Name | 4-methylpentyl 1-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 91699750 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 4-methylpentyl 1-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylate |
| SMILES | CC(C)CCCOC(=O)C1(NC(=O)OCc2ccccc2)CCCC1 |
| InChI | InChI=1S/C20H29NO4/c1-16(2)9-8-14-24-18(22)20(12-6-7-13-20)21-19(23)25-15-17-10-4-3-5-11-17/h3-5,10-11,16H,6-9,12-15H2,1-2H3,(H,21,23) |
| InChIKey | QHAOCASRSRSJMG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|