C18H24F3NO3Si2 — CID 91700187
[dimethyl(pyridin-3-ylmethoxy)silyl]oxy-dimethyl-[[2-(trifluoromethyl)phenyl]methoxy]silane (PubChem CID 91700187) has the molecular formula C18H24F3NO3Si2 and a molecular weight of 415.56 g/mol. Its IUPAC name is [dimethyl(pyridin-3-ylmethoxy)silyl]oxy-dimethyl-[[2-(trifluoromethyl)phenyl]methoxy]silane.
| Compound Name | [dimethyl(pyridin-3-ylmethoxy)silyl]oxy-dimethyl-[[2-(trifluoromethyl)phenyl]methoxy]silane |
|---|---|
| PubChem CID | 91700187 |
| Molecular Formula | C18H24F3NO3Si2 |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | [dimethyl(pyridin-3-ylmethoxy)silyl]oxy-dimethyl-[[2-(trifluoromethyl)phenyl]methoxy]silane |
| SMILES | C[Si](C)(OCc1cccnc1)O[Si](C)(C)OCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H24F3NO3Si2/c1-26(2,23-13-15-8-7-11-22-12-15)25-27(3,4)24-14-16-9-5-6-10-17(16)18(19,20)21/h5-12H,13-14H2,1-4H3 |
| InChIKey | MDAUWTOKBAROEN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|