About 1-O-(4-chloro-3-methylphenyl) 3-O-propyl 2,2-dimethylpropanedioate
1-O-(4-chloro-3-methylphenyl) 3-O-propyl 2,2-dimethylpropanedioate (PubChem CID 91701739) has the molecular formula C15H19ClO4
and a molecular weight of 298.77 g/mol. Its IUPAC name is 1-O-(4-chloro-3-methylphenyl) 3-O-propyl 2,2-dimethylpropanedioate.
Molecular Properties
| Compound Name | 1-O-(4-chloro-3-methylphenyl) 3-O-propyl 2,2-dimethylpropanedioate |
| PubChem CID | 91701739 |
| Molecular Formula | C15H19ClO4 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-O-(4-chloro-3-methylphenyl) 3-O-propyl 2,2-dimethylpropanedioate |
| SMILES | CCCOC(=O)C(C)(C)C(=O)Oc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C15H19ClO4/c1-5-8-19-13(17)15(3,4)14(18)20-11-6-7-12(16)10(2)9-11/h6-7,9H,5,8H2,1-4H3 |
| InChIKey | DCVXJPKVJBORMZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(4-chloro-3-methylphenyl) 3-O-propyl 2,2-dimethylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(4-chloro-3-methylphenyl) 3-O-propyl 2,2-dimethylpropanedioate?
The IUPAC name of 1-O-(4-chloro-3-methylphenyl) 3-O-propyl 2,2-dimethylpropanedioate (CID 91701739) is 1-O-(4-chloro-3-methylphenyl) 3-O-propyl 2,2-dimethylpropanedioate.
What is the SMILES notation for 1-O-(4-chloro-3-methylphenyl) 3-O-propyl 2,2-dimethylpropanedioate?
The canonical SMILES for 1-O-(4-chloro-3-methylphenyl) 3-O-propyl 2,2-dimethylpropanedioate is CCCOC(=O)C(C)(C)C(=O)Oc1ccc(Cl)c(C)c1.
What is the InChIKey of 1-O-(4-chloro-3-methylphenyl) 3-O-propyl 2,2-dimethylpropanedioate?
The InChIKey is DCVXJPKVJBORMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClO4/c1-5-8-19-13(17)15(3,4)14(18)20-11-6-7-12(16)10(2)9-11/h6-7,9H,5,8H2,1-4H3.
What are the key properties of 1-O-(4-chloro-3-methylphenyl) 3-O-propyl 2,2-dimethylpropanedioate?
1-O-(4-chloro-3-methylphenyl) 3-O-propyl 2,2-dimethylpropanedioate has a molecular weight of 298.77 g/mol, XLogP of 3.53, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(4-chloro-3-methylphenyl) 3-O-propyl 2,2-dimethylpropanedioate is sourced from PubChem (CID 91701739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).