About 2-methylpropyl 4-oxo-4-phenylbutanoate
2-methylpropyl 4-oxo-4-phenylbutanoate (PubChem CID 91703622) has the molecular formula C14H18O3
and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-methylpropyl 4-oxo-4-phenylbutanoate.
Molecular Properties
| Compound Name | 2-methylpropyl 4-oxo-4-phenylbutanoate |
| PubChem CID | 91703622 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2-methylpropyl 4-oxo-4-phenylbutanoate |
| SMILES | CC(C)COC(=O)CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18O3/c1-11(2)10-17-14(16)9-8-13(15)12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3 |
| InChIKey | JDSNVPCDHHNIPF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpropyl 4-oxo-4-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 4-oxo-4-phenylbutanoate?
The IUPAC name of 2-methylpropyl 4-oxo-4-phenylbutanoate (CID 91703622) is 2-methylpropyl 4-oxo-4-phenylbutanoate.
What is the SMILES notation for 2-methylpropyl 4-oxo-4-phenylbutanoate?
The canonical SMILES for 2-methylpropyl 4-oxo-4-phenylbutanoate is CC(C)COC(=O)CCC(=O)c1ccccc1.
What is the InChIKey of 2-methylpropyl 4-oxo-4-phenylbutanoate?
The InChIKey is JDSNVPCDHHNIPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c1-11(2)10-17-14(16)9-8-13(15)12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3.
What are the key properties of 2-methylpropyl 4-oxo-4-phenylbutanoate?
2-methylpropyl 4-oxo-4-phenylbutanoate has a molecular weight of 234.30 g/mol, XLogP of 2.85, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 4-oxo-4-phenylbutanoate is sourced from PubChem (CID 91703622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).