About 4-O-(2-fluorophenyl) 1-O-(2-phenylethyl) (E)-but-2-enedioate
4-O-(2-fluorophenyl) 1-O-(2-phenylethyl) (E)-but-2-enedioate (PubChem CID 91703749) has the molecular formula C18H15FO4
and a molecular weight of 314.31 g/mol. Its IUPAC name is 4-O-(2-fluorophenyl) 1-O-(2-phenylethyl) (E)-but-2-enedioate.
Molecular Properties
| Compound Name | 4-O-(2-fluorophenyl) 1-O-(2-phenylethyl) (E)-but-2-enedioate |
| PubChem CID | 91703749 |
| Molecular Formula | C18H15FO4 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-O-(2-fluorophenyl) 1-O-(2-phenylethyl) (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)Oc1ccccc1F)OCCc1ccccc1 |
| InChI | InChI=1S/C18H15FO4/c19-15-8-4-5-9-16(15)23-18(21)11-10-17(20)22-13-12-14-6-2-1-3-7-14/h1-11H,12-13H2/b11-10+ |
| InChIKey | CZALSJWRFPJZDH-ZHACJKMWSA-N |
| XLogP | 3.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(2-fluorophenyl) 1-O-(2-phenylethyl) (E)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(2-fluorophenyl) 1-O-(2-phenylethyl) (E)-but-2-enedioate?
The IUPAC name of 4-O-(2-fluorophenyl) 1-O-(2-phenylethyl) (E)-but-2-enedioate (CID 91703749) is 4-O-(2-fluorophenyl) 1-O-(2-phenylethyl) (E)-but-2-enedioate.
What is the SMILES notation for 4-O-(2-fluorophenyl) 1-O-(2-phenylethyl) (E)-but-2-enedioate?
The canonical SMILES for 4-O-(2-fluorophenyl) 1-O-(2-phenylethyl) (E)-but-2-enedioate is O=C(/C=C/C(=O)Oc1ccccc1F)OCCc1ccccc1.
What is the InChIKey of 4-O-(2-fluorophenyl) 1-O-(2-phenylethyl) (E)-but-2-enedioate?
The InChIKey is CZALSJWRFPJZDH-ZHACJKMWSA-N. The full InChI is InChI=1S/C18H15FO4/c19-15-8-4-5-9-16(15)23-18(21)11-10-17(20)22-13-12-14-6-2-1-3-7-14/h1-11H,12-13H2/b11-10+.
What are the key properties of 4-O-(2-fluorophenyl) 1-O-(2-phenylethyl) (E)-but-2-enedioate?
4-O-(2-fluorophenyl) 1-O-(2-phenylethyl) (E)-but-2-enedioate has a molecular weight of 314.31 g/mol, XLogP of 3.07, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(2-fluorophenyl) 1-O-(2-phenylethyl) (E)-but-2-enedioate is sourced from PubChem (CID 91703749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).