C19H11F7O3 — CID 91704017
[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91704017) has the molecular formula C19H11F7O3 and a molecular weight of 420.28 g/mol. Its IUPAC name is [4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91704017 |
| Molecular Formula | C19H11F7O3 |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | [4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(/C=C/c1ccc(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H11F7O3/c20-17(21,18(22,23)19(24,25)26)16(28)29-14-9-6-12(7-10-14)8-11-15(27)13-4-2-1-3-5-13/h1-11H/b11-8+ |
| InChIKey | MIURVQMQLAGUKP-DHZHZOJOSA-N |
| XLogP | 5.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|