C14H21NO3S — CID 91704817
4-methylpentyl 2-[methyl(thiophene-2-carbonyl)amino]acetate (PubChem CID 91704817) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 4-methylpentyl 2-[methyl(thiophene-2-carbonyl)amino]acetate.
| Compound Name | 4-methylpentyl 2-[methyl(thiophene-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 91704817 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-methylpentyl 2-[methyl(thiophene-2-carbonyl)amino]acetate |
| SMILES | CC(C)CCCOC(=O)CN(C)C(=O)c1cccs1 |
| InChI | InChI=1S/C14H21NO3S/c1-11(2)6-4-8-18-13(16)10-15(3)14(17)12-7-5-9-19-12/h5,7,9,11H,4,6,8,10H2,1-3H3 |
| InChIKey | AMMJBQUSLZXEPF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|