C25H44O4 — CID 91706487
5-O-decan-2-yl 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] pentanedioate (PubChem CID 91706487) has the molecular formula C25H44O4 and a molecular weight of 408.62 g/mol. Its IUPAC name is 5-O-decan-2-yl 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] pentanedioate.
| Compound Name | 5-O-decan-2-yl 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] pentanedioate |
|---|---|
| PubChem CID | 91706487 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | 5-O-decan-2-yl 1-O-[(2E)-3,7-dimethylocta-2,6-dienyl] pentanedioate |
| SMILES | CCCCCCCCC(C)OC(=O)CCCC(=O)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C25H44O4/c1-6-7-8-9-10-11-16-23(5)29-25(27)18-13-17-24(26)28-20-19-22(4)15-12-14-21(2)3/h14,19,23H,6-13,15-18,20H2,1-5H3/b22-19+ |
| InChIKey | TXLZHEILMHXOIY-ZBJSNUHESA-N |
| XLogP | 7.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|