About 5-O-[1-(3-bromophenyl)ethyl] 1-O-octyl pentanedioate
5-O-[1-(3-bromophenyl)ethyl] 1-O-octyl pentanedioate (PubChem CID 91709244) has the molecular formula C21H31BrO4
and a molecular weight of 427.38 g/mol. Its IUPAC name is 5-O-[1-(3-bromophenyl)ethyl] 1-O-octyl pentanedioate.
Molecular Properties
| Compound Name | 5-O-[1-(3-bromophenyl)ethyl] 1-O-octyl pentanedioate |
| PubChem CID | 91709244 |
| Molecular Formula | C21H31BrO4 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 5-O-[1-(3-bromophenyl)ethyl] 1-O-octyl pentanedioate |
| SMILES | CCCCCCCCOC(=O)CCCC(=O)OC(C)c1cccc(Br)c1 |
| InChI | InChI=1S/C21H31BrO4/c1-3-4-5-6-7-8-15-25-20(23)13-10-14-21(24)26-17(2)18-11-9-12-19(22)16-18/h9,11-12,16-17H,3-8,10,13-15H2,1-2H3 |
| InChIKey | JNEMNUUMSUVSCV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-O-[1-(3-bromophenyl)ethyl] 1-O-octyl pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-[1-(3-bromophenyl)ethyl] 1-O-octyl pentanedioate?
The IUPAC name of 5-O-[1-(3-bromophenyl)ethyl] 1-O-octyl pentanedioate (CID 91709244) is 5-O-[1-(3-bromophenyl)ethyl] 1-O-octyl pentanedioate.
What is the SMILES notation for 5-O-[1-(3-bromophenyl)ethyl] 1-O-octyl pentanedioate?
The canonical SMILES for 5-O-[1-(3-bromophenyl)ethyl] 1-O-octyl pentanedioate is CCCCCCCCOC(=O)CCCC(=O)OC(C)c1cccc(Br)c1.
What is the InChIKey of 5-O-[1-(3-bromophenyl)ethyl] 1-O-octyl pentanedioate?
The InChIKey is JNEMNUUMSUVSCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31BrO4/c1-3-4-5-6-7-8-15-25-20(23)13-10-14-21(24)26-17(2)18-11-9-12-19(22)16-18/h9,11-12,16-17H,3-8,10,13-15H2,1-2H3.
What are the key properties of 5-O-[1-(3-bromophenyl)ethyl] 1-O-octyl pentanedioate?
5-O-[1-(3-bromophenyl)ethyl] 1-O-octyl pentanedioate has a molecular weight of 427.38 g/mol, XLogP of 6.13, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-[1-(3-bromophenyl)ethyl] 1-O-octyl pentanedioate is sourced from PubChem (CID 91709244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).