C18H26BrNO3 — CID 71348751
octyl 2-[1-(3-bromophenyl)ethylamino]-2-oxoacetate (PubChem CID 71348751) has the molecular formula C18H26BrNO3 and a molecular weight of 384.31 g/mol. Its IUPAC name is octyl 2-[1-(3-bromophenyl)ethylamino]-2-oxoacetate.
| Compound Name | octyl 2-[1-(3-bromophenyl)ethylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 71348751 |
| Molecular Formula | C18H26BrNO3 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | octyl 2-[1-(3-bromophenyl)ethylamino]-2-oxoacetate |
| SMILES | CCCCCCCCOC(=O)C(=O)NC(C)c1cccc(Br)c1 |
| InChI | InChI=1S/C18H26BrNO3/c1-3-4-5-6-7-8-12-23-18(22)17(21)20-14(2)15-10-9-11-16(19)13-15/h9-11,13-14H,3-8,12H2,1-2H3,(H,20,21) |
| InChIKey | BFXQEAXLGVRJRN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|