C15H25O3P — CID 91711632
4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene (PubChem CID 91711632) has the molecular formula C15H25O3P and a molecular weight of 284.34 g/mol. Its IUPAC name is 4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene.
| Compound Name | 4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 91711632 |
| Molecular Formula | C15H25O3P |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene |
| SMILES | CCCCP(=O)(OCCC)Oc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H25O3P/c1-5-7-11-19(16,17-10-6-2)18-15-9-8-13(3)14(4)12-15/h8-9,12H,5-7,10-11H2,1-4H3 |
| InChIKey | FYZFYQMJAYHHCM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|