About 4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene
4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene (PubChem CID 91711632) has the molecular formula C15H25O3P
and a molecular weight of 284.34 g/mol. Its IUPAC name is 4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene.
Molecular Properties
| Compound Name | 4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene |
| PubChem CID | 91711632 |
| Molecular Formula | C15H25O3P |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene |
| SMILES | CCCCP(=O)(OCCC)Oc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H25O3P/c1-5-7-11-19(16,17-10-6-2)18-15-9-8-13(3)14(4)12-15/h8-9,12H,5-7,10-11H2,1-4H3 |
| InChIKey | FYZFYQMJAYHHCM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene?
The IUPAC name of 4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene (CID 91711632) is 4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene.
What is the SMILES notation for 4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene?
The canonical SMILES for 4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene is CCCCP(=O)(OCCC)Oc1ccc(C)c(C)c1.
What is the InChIKey of 4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene?
The InChIKey is FYZFYQMJAYHHCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25O3P/c1-5-7-11-19(16,17-10-6-2)18-15-9-8-13(3)14(4)12-15/h8-9,12H,5-7,10-11H2,1-4H3.
What are the key properties of 4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene?
4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene has a molecular weight of 284.34 g/mol, XLogP of 5.10, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[butyl(propoxy)phosphoryl]oxy-1,2-dimethylbenzene is sourced from PubChem (CID 91711632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).