C16H26ClO3P — CID 91738581
1-[butyl(4-methylpentoxy)phosphoryl]oxy-3-chlorobenzene (PubChem CID 91738581) has the molecular formula C16H26ClO3P and a molecular weight of 332.81 g/mol. Its IUPAC name is 1-[butyl(4-methylpentoxy)phosphoryl]oxy-3-chlorobenzene.
| Compound Name | 1-[butyl(4-methylpentoxy)phosphoryl]oxy-3-chlorobenzene |
|---|---|
| PubChem CID | 91738581 |
| Molecular Formula | C16H26ClO3P |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-[butyl(4-methylpentoxy)phosphoryl]oxy-3-chlorobenzene |
| SMILES | CCCCP(=O)(OCCCC(C)C)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H26ClO3P/c1-4-5-12-21(18,19-11-7-8-14(2)3)20-16-10-6-9-15(17)13-16/h6,9-10,13-14H,4-5,7-8,11-12H2,1-3H3 |
| InChIKey | LIPJNSZSFULEMZ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|