C23H30N2O3S — CID 91716737
N-[(1R,2R)-2-[(4-methylphenyl)sulfonyl-(2-phenylethyl)amino]cyclohexyl]acetamide (PubChem CID 91716737) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is N-[(1R,2R)-2-[(4-methylphenyl)sulfonyl-(2-phenylethyl)amino]cyclohexyl]acetamide.
| Compound Name | N-[(1R,2R)-2-[(4-methylphenyl)sulfonyl-(2-phenylethyl)amino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 91716737 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | N-[(1R,2R)-2-[(4-methylphenyl)sulfonyl-(2-phenylethyl)amino]cyclohexyl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCCC[C@H]1N(CCc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H30N2O3S/c1-18-12-14-21(15-13-18)29(27,28)25(17-16-20-8-4-3-5-9-20)23-11-7-6-10-22(23)24-19(2)26/h3-5,8-9,12-15,22-23H,6-7,10-11,16-17H2,1-2H3,(H,24,26)/t22-,23-/m1/s1 |
| InChIKey | BPOXRZCJZMLUDC-DHIUTWEWSA-N |
| XLogP | 3.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |