About 1-O-(naphthalen-2-ylmethyl) 4-O-(2-nitrophenyl) (E)-but-2-enedioate
1-O-(naphthalen-2-ylmethyl) 4-O-(2-nitrophenyl) (E)-but-2-enedioate (PubChem CID 91717295) has the molecular formula C21H15NO6
and a molecular weight of 377.35 g/mol. Its IUPAC name is 1-O-(naphthalen-2-ylmethyl) 4-O-(2-nitrophenyl) (E)-but-2-enedioate.
Molecular Properties
| Compound Name | 1-O-(naphthalen-2-ylmethyl) 4-O-(2-nitrophenyl) (E)-but-2-enedioate |
| PubChem CID | 91717295 |
| Molecular Formula | C21H15NO6 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 1-O-(naphthalen-2-ylmethyl) 4-O-(2-nitrophenyl) (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)Oc1ccccc1[N+](=O)[O-])OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H15NO6/c23-20(27-14-15-9-10-16-5-1-2-6-17(16)13-15)11-12-21(24)28-19-8-4-3-7-18(19)22(25)26/h1-13H,14H2/b12-11+ |
| InChIKey | KYXJFWKMIHDPSS-VAWYXSNFSA-N |
| XLogP | 3.95 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(naphthalen-2-ylmethyl) 4-O-(2-nitrophenyl) (E)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(naphthalen-2-ylmethyl) 4-O-(2-nitrophenyl) (E)-but-2-enedioate?
The IUPAC name of 1-O-(naphthalen-2-ylmethyl) 4-O-(2-nitrophenyl) (E)-but-2-enedioate (CID 91717295) is 1-O-(naphthalen-2-ylmethyl) 4-O-(2-nitrophenyl) (E)-but-2-enedioate.
What is the SMILES notation for 1-O-(naphthalen-2-ylmethyl) 4-O-(2-nitrophenyl) (E)-but-2-enedioate?
The canonical SMILES for 1-O-(naphthalen-2-ylmethyl) 4-O-(2-nitrophenyl) (E)-but-2-enedioate is O=C(/C=C/C(=O)Oc1ccccc1[N+](=O)[O-])OCc1ccc2ccccc2c1.
What is the InChIKey of 1-O-(naphthalen-2-ylmethyl) 4-O-(2-nitrophenyl) (E)-but-2-enedioate?
The InChIKey is KYXJFWKMIHDPSS-VAWYXSNFSA-N. The full InChI is InChI=1S/C21H15NO6/c23-20(27-14-15-9-10-16-5-1-2-6-17(16)13-15)11-12-21(24)28-19-8-4-3-7-18(19)22(25)26/h1-13H,14H2/b12-11+.
What are the key properties of 1-O-(naphthalen-2-ylmethyl) 4-O-(2-nitrophenyl) (E)-but-2-enedioate?
1-O-(naphthalen-2-ylmethyl) 4-O-(2-nitrophenyl) (E)-but-2-enedioate has a molecular weight of 377.35 g/mol, XLogP of 3.95, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(naphthalen-2-ylmethyl) 4-O-(2-nitrophenyl) (E)-but-2-enedioate is sourced from PubChem (CID 91717295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).