C15H16F7NO2 — CID 91719559
2-(N-ethyl-3-methylanilino)ethyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91719559) has the molecular formula C15H16F7NO2 and a molecular weight of 375.28 g/mol. Its IUPAC name is 2-(N-ethyl-3-methylanilino)ethyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | 2-(N-ethyl-3-methylanilino)ethyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91719559 |
| Molecular Formula | C15H16F7NO2 |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 2-(N-ethyl-3-methylanilino)ethyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CCN(CCOC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1cccc(C)c1 |
| InChI | InChI=1S/C15H16F7NO2/c1-3-23(11-6-4-5-10(2)9-11)7-8-25-12(24)13(16,17)14(18,19)15(20,21)22/h4-6,9H,3,7-8H2,1-2H3 |
| InChIKey | PTGIOONROYONRR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|