C22H35NO3Si — CID 91721248
(1-phenyl-2-trimethylsilyloxyethyl) 8-propan-2-yl-8-azabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 91721248) has the molecular formula C22H35NO3Si and a molecular weight of 389.61 g/mol. Its IUPAC name is (1-phenyl-2-trimethylsilyloxyethyl) 8-propan-2-yl-8-azabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | (1-phenyl-2-trimethylsilyloxyethyl) 8-propan-2-yl-8-azabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 91721248 |
| Molecular Formula | C22H35NO3Si |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | (1-phenyl-2-trimethylsilyloxyethyl) 8-propan-2-yl-8-azabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | CC(C)N1C2CCC1CC(C(=O)OC(CO[Si](C)(C)C)c1ccccc1)C2 |
| InChI | InChI=1S/C22H35NO3Si/c1-16(2)23-19-11-12-20(23)14-18(13-19)22(24)26-21(15-25-27(3,4)5)17-9-7-6-8-10-17/h6-10,16,18-21H,11-15H2,1-5H3 |
| InChIKey | FNFWPBCJIYRYJV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|