C26H43NO3Si — CID 162415172
1-butyl-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-phenylmethoxy-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 162415172) has the molecular formula C26H43NO3Si and a molecular weight of 445.72 g/mol. Its IUPAC name is 1-butyl-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-phenylmethoxy-8-azabicyclo[3.2.1]octan-3-one.
| Compound Name | 1-butyl-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-phenylmethoxy-8-azabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 162415172 |
| Molecular Formula | C26H43NO3Si |
| Molecular Weight | 445.72 g/mol |
| Exact Mass | 445.30 |
| IUPAC Name | 1-butyl-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-phenylmethoxy-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | CCCCC12CC(=O)CC(CC1OCc1ccccc1)N2CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H43NO3Si/c1-7-8-14-26-19-23(28)17-22(18-24(26)29-20-21-12-10-9-11-13-21)27(26)15-16-30-31(5,6)25(2,3)4/h9-13,22,24H,7-8,14-20H2,1-6H3 |
| InChIKey | IFMOUXJGXONVGM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.72 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|