C21H33NO3Si — CID 11440271
(1S,2R,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxy-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one (PubChem CID 11440271) has the molecular formula C21H33NO3Si and a molecular weight of 375.59 g/mol. Its IUPAC name is (1S,2R,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxy-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one.
| Compound Name | (1S,2R,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxy-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one |
|---|---|
| PubChem CID | 11440271 |
| Molecular Formula | C21H33NO3Si |
| Molecular Weight | 375.59 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (1S,2R,8aS)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxy-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CN2CCC(=O)C[C@H]2[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H33NO3Si/c1-21(2,3)26(4,5)25-19-14-22-12-11-17(23)13-18(22)20(19)24-15-16-9-7-6-8-10-16/h6-10,18-20H,11-15H2,1-5H3/t18-,19+,20-/m0/s1 |
| InChIKey | OOCZTLNFLGMTKO-ZCNNSNEGSA-N |
| XLogP | 4.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|