C26H43NO4Si — CID 10695330
(5R,6R)-4-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-6-phenyl-5-(2-trimethylsilylethoxy)oxan-2-one (PubChem CID 10695330) has the molecular formula C26H43NO4Si and a molecular weight of 461.72 g/mol. Its IUPAC name is (5R,6R)-4-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-6-phenyl-5-(2-trimethylsilylethoxy)oxan-2-one.
| Compound Name | (5R,6R)-4-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-6-phenyl-5-(2-trimethylsilylethoxy)oxan-2-one |
|---|---|
| PubChem CID | 10695330 |
| Molecular Formula | C26H43NO4Si |
| Molecular Weight | 461.72 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | (5R,6R)-4-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-6-phenyl-5-(2-trimethylsilylethoxy)oxan-2-one |
| SMILES | CCC(CC)(OC)[C@@H]1CCCN1C1CC(=O)O[C@H](c2ccccc2)[C@@H]1OCC[Si](C)(C)C |
| InChI | InChI=1S/C26H43NO4Si/c1-7-26(8-2,29-3)22-15-12-16-27(22)21-19-23(28)31-24(20-13-10-9-11-14-20)25(21)30-17-18-32(4,5)6/h9-11,13-14,21-22,24-25H,7-8,12,15-19H2,1-6H3/t21?,22-,24+,25+/m0/s1 |
| InChIKey | QTBVJDIFDISKOV-KVFQWPPYSA-N |
| XLogP | 5.44 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.72 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|