C25H39NO5Si — CID 15416235
benzyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1-ethoxy-1-oxopent-4-en-2-yl)pyrrolidine-1-carboxylate (PubChem CID 15416235) has the molecular formula C25H39NO5Si and a molecular weight of 461.68 g/mol. Its IUPAC name is benzyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1-ethoxy-1-oxopent-4-en-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1-ethoxy-1-oxopent-4-en-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15416235 |
| Molecular Formula | C25H39NO5Si |
| Molecular Weight | 461.68 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | benzyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1-ethoxy-1-oxopent-4-en-2-yl)pyrrolidine-1-carboxylate |
| SMILES | C=CCC(C(=O)OCC)[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H39NO5Si/c1-8-13-20(23(27)29-9-2)22-21(31-32(6,7)25(3,4)5)16-17-26(22)24(28)30-18-19-14-11-10-12-15-19/h8,10-12,14-15,20-22H,1,9,13,16-18H2,2-7H3/t20?,21-,22+/m0/s1 |
| InChIKey | PYVKOOLTCXDJTO-JTGIGXABSA-N |
| XLogP | 5.54 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.68 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|