C22H34BrNO3Si — CID 132918948
1-bromo-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-phenylmethoxy-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 132918948) has the molecular formula C22H34BrNO3Si and a molecular weight of 468.51 g/mol. Its IUPAC name is 1-bromo-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-phenylmethoxy-8-azabicyclo[3.2.1]octan-3-one.
| Compound Name | 1-bromo-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-phenylmethoxy-8-azabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 132918948 |
| Molecular Formula | C22H34BrNO3Si |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 1-bromo-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-phenylmethoxy-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCN1C2CC(=O)CC1(Br)C(OCc1ccccc1)C2 |
| InChI | InChI=1S/C22H34BrNO3Si/c1-21(2,3)28(4,5)27-12-11-24-18-13-19(25)15-22(24,23)20(14-18)26-16-17-9-7-6-8-10-17/h6-10,18,20H,11-16H2,1-5H3 |
| InChIKey | LRWUCTBAVALVAR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|