C21H32BrNO3Si — CID 10647367
(2R,6R,8R,8aS)-8-bromo-6-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 10647367) has the molecular formula C21H32BrNO3Si and a molecular weight of 454.48 g/mol. Its IUPAC name is (2R,6R,8R,8aS)-8-bromo-6-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (2R,6R,8R,8aS)-8-bromo-6-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 10647367 |
| Molecular Formula | C21H32BrNO3Si |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | (2R,6R,8R,8aS)-8-bromo-6-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H](Br)[C@@H]2C[C@@H](OCc3ccccc3)C(=O)N2C1 |
| InChI | InChI=1S/C21H32BrNO3Si/c1-21(2,3)27(4,5)26-16-11-17(22)18-12-19(20(24)23(18)13-16)25-14-15-9-7-6-8-10-15/h6-10,16-19H,11-14H2,1-5H3/t16-,17-,18+,19-/m1/s1 |
| InChIKey | NIPCWXKGRDJUJQ-AKHDSKFASA-N |
| XLogP | 4.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|