C27H37NO3SeSi — CID 10626055
(2R,6R,8R,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxy-8-phenylselanyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 10626055) has the molecular formula C27H37NO3SeSi and a molecular weight of 530.64 g/mol. Its IUPAC name is (2R,6R,8R,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxy-8-phenylselanyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (2R,6R,8R,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxy-8-phenylselanyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 10626055 |
| Molecular Formula | C27H37NO3SeSi |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | (2R,6R,8R,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxy-8-phenylselanyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]([Se]c2ccccc2)[C@@H]2C[C@@H](OCc3ccccc3)C(=O)N2C1 |
| InChI | InChI=1S/C27H37NO3SeSi/c1-27(2,3)33(4,5)31-21-16-25(32-22-14-10-7-11-15-22)23-17-24(26(29)28(23)18-21)30-19-20-12-8-6-9-13-20/h6-15,21,23-25H,16-19H2,1-5H3/t21-,23+,24-,25-/m1/s1 |
| InChIKey | FXONESYZJYGYMA-RVFVQDDPSA-N |
| XLogP | 4.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|