C23H37NO3Si — CID 57332182
(4R)-1-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-phenylmethoxypyrrolidin-2-one (PubChem CID 57332182) has the molecular formula C23H37NO3Si and a molecular weight of 403.64 g/mol. Its IUPAC name is (4R)-1-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-phenylmethoxypyrrolidin-2-one.
| Compound Name | (4R)-1-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-phenylmethoxypyrrolidin-2-one |
|---|---|
| PubChem CID | 57332182 |
| Molecular Formula | C23H37NO3Si |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (4R)-1-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-4-phenylmethoxypyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCCC[C@H]1N1C[C@H](OCc2ccccc2)CC1=O |
| InChI | InChI=1S/C23H37NO3Si/c1-23(2,3)28(4,5)27-21-14-10-9-13-20(21)24-16-19(15-22(24)25)26-17-18-11-7-6-8-12-18/h6-8,11-12,19-21H,9-10,13-17H2,1-5H3/t19-,20-,21-/m1/s1 |
| InChIKey | LQSHDMWGXWWDTC-NJDAHSKKSA-N |
| XLogP | 5.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|