C32H42INO4SSi — CID 24862497
(E,2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-3-iodoprop-2-enyl]-6-phenylmethoxyhex-4-en-1-one (PubChem CID 24862497) has the molecular formula C32H42INO4SSi and a molecular weight of 691.75 g/mol. Its IUPAC name is (E,2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-3-iodoprop-2-enyl]-6-phenylmethoxyhex-4-en-1-one.
| Compound Name | (E,2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-3-iodoprop-2-enyl]-6-phenylmethoxyhex-4-en-1-one |
|---|---|
| PubChem CID | 24862497 |
| Molecular Formula | C32H42INO4SSi |
| Molecular Weight | 691.75 g/mol |
| Exact Mass | 691.16 |
| IUPAC Name | (E,2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-3-iodoprop-2-enyl]-6-phenylmethoxyhex-4-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](/C=C/COCc1ccccc1)[C@H](C/C=C\I)C(=O)N1C(=S)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C32H42INO4SSi/c1-32(2,3)40(4,5)38-29(19-13-21-36-23-26-16-10-7-11-17-26)28(18-12-20-33)30(35)34-27(24-37-31(34)39)22-25-14-8-6-9-15-25/h6-17,19-20,27-29H,18,21-24H2,1-5H3/b19-13+,20-12-/t27-,28-,29+/m0/s1 |
| InChIKey | BBWQABATJZUNAI-VAAZNGGRSA-N |
| XLogP | 7.86 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.75 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|