C31H45NO4SSi — CID 135023385
(2S,3R,6R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-phenylmethoxyheptan-1-one (PubChem CID 135023385) has the molecular formula C31H45NO4SSi and a molecular weight of 555.86 g/mol. Its IUPAC name is (2S,3R,6R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-phenylmethoxyheptan-1-one.
| Compound Name | (2S,3R,6R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-phenylmethoxyheptan-1-one |
|---|---|
| PubChem CID | 135023385 |
| Molecular Formula | C31H45NO4SSi |
| Molecular Weight | 555.86 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | (2S,3R,6R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-phenylmethoxyheptan-1-one |
| SMILES | C[C@H](CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)N1C(=S)OC[C@@H]1Cc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C31H45NO4SSi/c1-23(34-21-26-16-12-9-13-17-26)18-19-28(36-38(6,7)31(3,4)5)24(2)29(33)32-27(22-35-30(32)37)20-25-14-10-8-11-15-25/h8-17,23-24,27-28H,18-22H2,1-7H3/t23-,24+,27+,28-/m1/s1 |
| InChIKey | PBFFGCGTJZZDBC-YFQNEARWSA-N |
| XLogP | 7.15 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.86 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|