C30H37NO5S — CID 11504613
(2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-[(2R)-4-methyl-1-phenylmethoxypent-4-en-2-yl]oxyhept-6-en-1-one (PubChem CID 11504613) has the molecular formula C30H37NO5S and a molecular weight of 523.70 g/mol. Its IUPAC name is (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-[(2R)-4-methyl-1-phenylmethoxypent-4-en-2-yl]oxyhept-6-en-1-one.
| Compound Name | (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-[(2R)-4-methyl-1-phenylmethoxypent-4-en-2-yl]oxyhept-6-en-1-one |
|---|---|
| PubChem CID | 11504613 |
| Molecular Formula | C30H37NO5S |
| Molecular Weight | 523.70 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-[(2R)-4-methyl-1-phenylmethoxypent-4-en-2-yl]oxyhept-6-en-1-one |
| SMILES | C=CCC[C@@H](O)[C@H](O[C@@H](COCc1ccccc1)CC(=C)C)C(=O)N1C(=S)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C30H37NO5S/c1-4-5-16-27(32)28(36-26(17-22(2)3)21-34-19-24-14-10-7-11-15-24)29(33)31-25(20-35-30(31)37)18-23-12-8-6-9-13-23/h4,6-15,25-28,32H,1-2,5,16-21H2,3H3/t25-,26+,27+,28-/m0/s1 |
| InChIKey | XGCKYSKJRZEFEN-HFLBTKGNSA-N |
| XLogP | 5.01 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.70 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|