C19H25NO4S — CID 101235876
(2R,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-4-methyl-2-prop-2-enoxypentan-1-one (PubChem CID 101235876) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is (2R,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-4-methyl-2-prop-2-enoxypentan-1-one.
| Compound Name | (2R,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-4-methyl-2-prop-2-enoxypentan-1-one |
|---|---|
| PubChem CID | 101235876 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (2R,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-4-methyl-2-prop-2-enoxypentan-1-one |
| SMILES | C=CCO[C@@H](C(=O)N1C(=S)OC[C@@H]1Cc1ccccc1)[C@H](O)C(C)C |
| InChI | InChI=1S/C19H25NO4S/c1-4-10-23-17(16(21)13(2)3)18(22)20-15(12-24-19(20)25)11-14-8-6-5-7-9-14/h4-9,13,15-17,21H,1,10-12H2,2-3H3/t15-,16+,17+/m0/s1 |
| InChIKey | QLHRITRGRBLTNL-GVDBMIGSSA-N |
| XLogP | 2.33 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|