C25H31NO4Si — CID 134872210
(3R,4R)-3,4-bis(phenylmethoxy)-1-[(Z)-4-trimethylsilylbut-3-enyl]pyrrolidine-2,5-dione (PubChem CID 134872210) has the molecular formula C25H31NO4Si and a molecular weight of 437.61 g/mol. Its IUPAC name is (3R,4R)-3,4-bis(phenylmethoxy)-1-[(Z)-4-trimethylsilylbut-3-enyl]pyrrolidine-2,5-dione.
| Compound Name | (3R,4R)-3,4-bis(phenylmethoxy)-1-[(Z)-4-trimethylsilylbut-3-enyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134872210 |
| Molecular Formula | C25H31NO4Si |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (3R,4R)-3,4-bis(phenylmethoxy)-1-[(Z)-4-trimethylsilylbut-3-enyl]pyrrolidine-2,5-dione |
| SMILES | C[Si](C)(C)/C=C\CCN1C(=O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C1=O |
| InChI | InChI=1S/C25H31NO4Si/c1-31(2,3)17-11-10-16-26-24(27)22(29-18-20-12-6-4-7-13-20)23(25(26)28)30-19-21-14-8-5-9-15-21/h4-9,11-15,17,22-23H,10,16,18-19H2,1-3H3/b17-11-/t22-,23-/m1/s1 |
| InChIKey | BLBADQMEPWCRPW-DMEDHGNASA-N |
| XLogP | 4.35 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|