C22H23NO4 — CID 14503836
(3R,4R)-1-but-3-enyl-3,4-bis(phenylmethoxy)pyrrolidine-2,5-dione (PubChem CID 14503836) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is (3R,4R)-1-but-3-enyl-3,4-bis(phenylmethoxy)pyrrolidine-2,5-dione.
| Compound Name | (3R,4R)-1-but-3-enyl-3,4-bis(phenylmethoxy)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 14503836 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (3R,4R)-1-but-3-enyl-3,4-bis(phenylmethoxy)pyrrolidine-2,5-dione |
| SMILES | C=CCCN1C(=O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C1=O |
| InChI | InChI=1S/C22H23NO4/c1-2-3-14-23-21(24)19(26-15-17-10-6-4-7-11-17)20(22(23)25)27-16-18-12-8-5-9-13-18/h2,4-13,19-20H,1,3,14-16H2/t19-,20-/m1/s1 |
| InChIKey | ZRZMXESGGCQJLN-WOJBJXKFSA-N |
| XLogP | 3.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|