C24H29NO5Se — CID 59910084
(2R,3R)-3-hydroxy-2,4-bis(phenylmethoxy)-1-[(4S)-4-propan-2-yl-2-selanylidene-1,3-oxazolidin-3-yl]butan-1-one (PubChem CID 59910084) has the molecular formula C24H29NO5Se and a molecular weight of 490.46 g/mol. Its IUPAC name is (2R,3R)-3-hydroxy-2,4-bis(phenylmethoxy)-1-[(4S)-4-propan-2-yl-2-selanylidene-1,3-oxazolidin-3-yl]butan-1-one.
| Compound Name | (2R,3R)-3-hydroxy-2,4-bis(phenylmethoxy)-1-[(4S)-4-propan-2-yl-2-selanylidene-1,3-oxazolidin-3-yl]butan-1-one |
|---|---|
| PubChem CID | 59910084 |
| Molecular Formula | C24H29NO5Se |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | (2R,3R)-3-hydroxy-2,4-bis(phenylmethoxy)-1-[(4S)-4-propan-2-yl-2-selanylidene-1,3-oxazolidin-3-yl]butan-1-one |
| SMILES | CC(C)[C@H]1COC(=[Se])N1C(=O)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C24H29NO5Se/c1-17(2)20-15-30-24(31)25(20)23(27)22(29-14-19-11-7-4-8-12-19)21(26)16-28-13-18-9-5-3-6-10-18/h3-12,17,20-22,26H,13-16H2,1-2H3/t20-,21-,22-/m1/s1 |
| InChIKey | QKRBKZQCVGKBRD-YPAWHYETSA-N |
| XLogP | 2.29 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|