C17H21NO3Se — CID 101070992
(E,2R,3S)-3-hydroxy-2-methyl-1-[(4S,5R)-4-methyl-5-phenyl-2-selanylidene-1,3-oxazolidin-3-yl]hex-4-en-1-one (PubChem CID 101070992) has the molecular formula C17H21NO3Se and a molecular weight of 366.32 g/mol. Its IUPAC name is (E,2R,3S)-3-hydroxy-2-methyl-1-[(4S,5R)-4-methyl-5-phenyl-2-selanylidene-1,3-oxazolidin-3-yl]hex-4-en-1-one.
| Compound Name | (E,2R,3S)-3-hydroxy-2-methyl-1-[(4S,5R)-4-methyl-5-phenyl-2-selanylidene-1,3-oxazolidin-3-yl]hex-4-en-1-one |
|---|---|
| PubChem CID | 101070992 |
| Molecular Formula | C17H21NO3Se |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | (E,2R,3S)-3-hydroxy-2-methyl-1-[(4S,5R)-4-methyl-5-phenyl-2-selanylidene-1,3-oxazolidin-3-yl]hex-4-en-1-one |
| SMILES | C/C=C/[C@H](O)[C@@H](C)C(=O)N1C(=[Se])O[C@H](c2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C17H21NO3Se/c1-4-8-14(19)11(2)16(20)18-12(3)15(21-17(18)22)13-9-6-5-7-10-13/h4-12,14-15,19H,1-3H3/b8-4+/t11-,12+,14+,15+/m1/s1 |
| InChIKey | VGEYXPMKEZGGAY-SLUJJSFFSA-N |
| XLogP | 1.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|